CAS 1210300-43-8 appears in our catalog under these names: 2-([3-(Trifluoromethyl)phenyl]amino)pyridine-3-carboxylic acid hydrochloride, 95%, 2-{(3-(trifluoromethyl)phenyl)amino}pyridine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid;hydrochloride (CAS 1210300-43-8) is a chemical compound with the molecular formula C13H10ClF3N2O2 and a molecular weight of 318.68 g/mol. IUPAC name: 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid;hydrochloride. InChIKey: WXILILUHYSEXKI-UHFFFAOYSA-N.
| Molecular formula | C13H10ClF3N2O2 |
|---|---|
| Molecular weight | 318.68 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | WXILILUHYSEXKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC2=C(C=CC=N2)C(=O)O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)