Products 2869830-81-7
CAS 2869830-81-7 is the registry number for 6-Chloro-2-(4-methoxybenzyl)-4-(trifluoromethyl)pyridazin-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)pyridazin-3-one (CAS 2869830-81-7) is a chemical compound with the molecular formula C13H10ClF3N2O2 and a molecular weight of 318.68 g/mol. IUPAC name: 6-chloro-2-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)pyridazin-3-one. InChIKey: MZKVRQFKWDTBAT-UHFFFAOYSA-N.
| Molecular formula | C13H10ClF3N2O2 |
|---|---|
| Molecular weight | 318.68 g/mol |
| IUPAC name | 6-chloro-2-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)pyridazin-3-one |
| InChIKey | MZKVRQFKWDTBAT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=O)C(=CC(=N2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)