Products 1210397-97-9
CAS 1210397-97-9 is the registry number for N-(4-Bromobenzyl)-N,3,3-trimethylbutanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(4-bromophenyl)methyl]-N,3,3-trimethylbutanamide (CAS 1210397-97-9) is a chemical compound with the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. IUPAC name: N-[(4-bromophenyl)methyl]-N,3,3-trimethylbutanamide. InChIKey: BQFWMPGTHDRRBY-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO |
|---|---|
| Molecular weight | 298.22 g/mol |
| IUPAC name | N-[(4-bromophenyl)methyl]-N,3,3-trimethylbutanamide |
| InChIKey | BQFWMPGTHDRRBY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)N(C)CC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)