Products 1375931-07-9
CAS 1375931-07-9 is the registry number for 2-Bromo-4-methyl-N,N-bis(1-methylethyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
2-bromo-4-methyl-N,N-di(propan-2-yl)benzamide (CAS 1375931-07-9) is a chemical compound with the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. IUPAC name: 2-bromo-4-methyl-N,N-di(propan-2-yl)benzamide. InChIKey: MSGKAHYTCBGYES-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO |
|---|---|
| Molecular weight | 298.22 g/mol |
| IUPAC name | 2-bromo-4-methyl-N,N-di(propan-2-yl)benzamide |
| InChIKey | MSGKAHYTCBGYES-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)N(C(C)C)C(C)C)Br |
Computed by PubChem (NCBI)