CAS 1210410-35-7 appears in our catalog under these names: Sodium Propionate-3,3,3-d3, 99 atom % D, min 98% Chemical Purity, Sodium Propionate–d3, Sodium propionate-d3, 98.38%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 1g, 0,5g, 10mg, 100mg, 25mg, 50mg, 10 mg, 100 mg.
Sodium 3,3,3-trideuteriopropanoate (CAS 1210410-35-7) is a chemical compound with the molecular formula C3H5NaO2 and a molecular weight of 99.08 g/mol. IUPAC name: sodium 3,3,3-trideuteriopropanoate. InChIKey: JXKPEJDQGNYQSM-NIIDSAIPSA-M.
| Molecular formula | C3H5NaO2 |
|---|---|
| Molecular weight | 99.08 g/mol |
| IUPAC name | sodium 3,3,3-trideuteriopropanoate |
| InChIKey | JXKPEJDQGNYQSM-NIIDSAIPSA-M |
| SMILES | [2H]C([2H])([2H])CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)