CAS 202529-18-8 appears in our catalog under these names: Sodium Propionate-d5, 98 atom % D, min 98% Chemical Purity, Sodium Propionate-d5, >95% (HPLC), Propanoic–d5 sodium, Sodium propionate-d5, 99.91%. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 1g, 0,5g, 100mg, 10mg, 50mg, 25mg, 10 mg, 100 mg.
Sodium 2,2,3,3,3-pentadeuteriopropanoate (CAS 202529-18-8) is a chemical compound with the molecular formula C3H5NaO2 and a molecular weight of 101.09 g/mol. IUPAC name: sodium 2,2,3,3,3-pentadeuteriopropanoate. InChIKey: JXKPEJDQGNYQSM-LUIAAVAXSA-M.
| Molecular formula | C3H5NaO2 |
|---|---|
| Molecular weight | 101.09 g/mol |
| IUPAC name | sodium 2,2,3,3,3-pentadeuteriopropanoate |
| InChIKey | JXKPEJDQGNYQSM-LUIAAVAXSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)