CAS 1210419-05-8 is the registry number for 5-Fluoro-6-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluoropyridine-2-carboxylic acid (CAS 1210419-05-8) is a chemical compound with the molecular formula C14H14FNO4 and a molecular weight of 279.26 g/mol. IUPAC name: 6-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluoropyridine-2-carboxylic acid. InChIKey: CUBQQMVNYBVYFB-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO4 |
|---|---|
| Molecular weight | 279.26 g/mol |
| IUPAC name | 6-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluoropyridine-2-carboxylic acid |
| InChIKey | CUBQQMVNYBVYFB-UHFFFAOYSA-N |
| SMILES | C1CC2(CC=C1C3=C(C=CC(=N3)C(=O)O)F)OCCO2 |
Computed by PubChem (NCBI)