Products 1260775-74-3

CAS 1260775-74-3 is the registry number for 1-(1,1-Dimethylethyl) 5-fluoro-1H-indole-1,3-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

5-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indole-3-carboxylic acid (CAS 1260775-74-3) is a chemical compound with the molecular formula C14H14FNO4 and a molecular weight of 279.26 g/mol. IUPAC name: 5-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indole-3-carboxylic acid. InChIKey: YFVMKCAUSRHWAY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14FNO4
Molecular weight279.26 g/mol
IUPAC name5-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indole-3-carboxylic acid
InChIKeyYFVMKCAUSRHWAY-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)F)C(=O)O

Computed by PubChem (NCBI)