CAS 1260775-74-3 is the registry number for 1-(1,1-Dimethylethyl) 5-fluoro-1H-indole-1,3-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
5-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indole-3-carboxylic acid (CAS 1260775-74-3) is a chemical compound with the molecular formula C14H14FNO4 and a molecular weight of 279.26 g/mol. IUPAC name: 5-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indole-3-carboxylic acid. InChIKey: YFVMKCAUSRHWAY-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO4 |
|---|---|
| Molecular weight | 279.26 g/mol |
| IUPAC name | 5-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indole-3-carboxylic acid |
| InChIKey | YFVMKCAUSRHWAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)