Products 1210529-03-5
CAS 1210529-03-5 appears in our catalog under these names: 1-(3-Fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethan-1-one dihydrochloride, 95%, 1-(3-Fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethan-1-one dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(3-fluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone;dihydrochloride (CAS 1210529-03-5) is a chemical compound with the molecular formula C10H10Cl2FN3O and a molecular weight of 278.11 g/mol. IUPAC name: 1-(3-fluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone;dihydrochloride. InChIKey: XZOPUELNDIKXEZ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2FN3O |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone;dihydrochloride |
| InChIKey | XZOPUELNDIKXEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)CN2C=NC=N2.Cl.Cl |
Computed by PubChem (NCBI)