Products 1431967-81-5
CAS 1431967-81-5 is the registry number for 3-(4-Chloro-3-fluorophenoxy)-1-methyl-1H-pyrazol-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-chloro-3-fluorophenoxy)-1-methylpyrazol-4-amine;hydrochloride (CAS 1431967-81-5) is a chemical compound with the molecular formula C10H10Cl2FN3O and a molecular weight of 278.11 g/mol. IUPAC name: 3-(4-chloro-3-fluorophenoxy)-1-methylpyrazol-4-amine;hydrochloride. InChIKey: JIYUHJHMKVROOJ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2FN3O |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | 3-(4-chloro-3-fluorophenoxy)-1-methylpyrazol-4-amine;hydrochloride |
| InChIKey | JIYUHJHMKVROOJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)OC2=CC(=C(C=C2)Cl)F)N.Cl |
Computed by PubChem (NCBI)