Products 1210646-94-8

CAS 1210646-94-8 is the registry number for 5-Amino-3-chloro-4-isothiazolecarboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g.

Structural formula: {0} (CAS {1})

5-amino-3-chloro-1,2-thiazole-4-carboxylic acid (CAS 1210646-94-8) is a chemical compound with the molecular formula C4H3ClN2O2S and a molecular weight of 178.60 g/mol. IUPAC name: 5-amino-3-chloro-1,2-thiazole-4-carboxylic acid. InChIKey: HUSPUEYRNBVICC-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3ClN2O2S
Molecular weight178.60 g/mol
IUPAC name5-amino-3-chloro-1,2-thiazole-4-carboxylic acid
InChIKeyHUSPUEYRNBVICC-UHFFFAOYSA-N
SMILESC1(=C(SN=C1Cl)N)C(=O)O

Computed by PubChem (NCBI)