Products 1505316-34-6

CAS 1505316-34-6 is the registry number for 4-Amino-2-chlorothiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-amino-2-chloro-1,3-thiazole-5-carboxylic acid (CAS 1505316-34-6) is a chemical compound with the molecular formula C4H3ClN2O2S and a molecular weight of 178.60 g/mol. IUPAC name: 4-amino-2-chloro-1,3-thiazole-5-carboxylic acid. InChIKey: WVLWVOBFLSMLAG-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3ClN2O2S
Molecular weight178.60 g/mol
IUPAC name4-amino-2-chloro-1,3-thiazole-5-carboxylic acid
InChIKeyWVLWVOBFLSMLAG-UHFFFAOYSA-N
SMILESC1(=C(N=C(S1)Cl)N)C(=O)O

Computed by PubChem (NCBI)