CAS 121067-66-1 appears in our catalog under these names: D–Sorbitol–13C6, D-Glucitol-13C6, >95% (HPLC), D-Sorbitol-13C6, 99.94%. Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 1mg, 50mg, 5mg, 10mg, 5 mg, 1 mg, 10 mg.
(2S,3R,4R,5R)-(1,2,3,4,5,6-13C6)hexane-1,2,3,4,5,6-hexol (CAS 121067-66-1) is a chemical compound with the molecular formula C6H14O6 and a molecular weight of 188.13 g/mol. IUPAC name: (2S,3R,4R,5R)-(1,2,3,4,5,6-13C6)hexane-1,2,3,4,5,6-hexol. InChIKey: FBPFZTCFMRRESA-GVZKVBLJSA-N.
| Molecular formula | C6H14O6 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | (2S,3R,4R,5R)-(1,2,3,4,5,6-13C6)hexane-1,2,3,4,5,6-hexol |
| InChIKey | FBPFZTCFMRRESA-GVZKVBLJSA-N |
| SMILES | [13CH2]([13C@H]([13C@H]([13C@@H]([13C@H]([13CH2]O)O)O)O)O)O |
Computed by PubChem (NCBI)