CAS 6155-35-7 appears in our catalog under these names: alpha-L-Rhamnose Monohydrate, L-Rhamnose Monohydrate, >95% (HPLC), α-L-Rhamnose monohydrate/ 100%, α–L–Rhamnose monohydrate, α-L-Rhamnose monohydrate. Offered by: Mikromol, LoGiCal, TRC, TargetMol, GLPBio. Available pack sizes: 250mg, 10mg, 100g, 10g, 50g, 100mg, 10mM (in 1ml water), 500mg.
(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;hydrate (CAS 6155-35-7) is a chemical compound with the molecular formula C6H14O6 and a molecular weight of 182.17 g/mol. IUPAC name: (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;hydrate. InChIKey: CBDCDOTZPYZPRO-DEZHIRTDSA-N.
| Molecular formula | C6H14O6 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;hydrate |
| InChIKey | CBDCDOTZPYZPRO-DEZHIRTDSA-N |
| SMILES | C[C@@H]([C@@H]([C@H]([C@H](C=O)O)O)O)O.O |
Computed by PubChem (NCBI)