CAS 12107-76-5 appears in our catalog under these names: Di-n-butylammonium tetrafluoroborate, 95%, Dibutylammonium tetrafluoroborate, 97%, Di-n-Butylammonium tetrafluoroborate. Offered by: Combi-blocks, Chemat Brand, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, on request.
Dibutylazanium tetrafluoroborate (CAS 12107-76-5) is a chemical compound with the molecular formula C8H20BF4N and a molecular weight of 217.06 g/mol. IUPAC name: dibutylazanium tetrafluoroborate. InChIKey: CAZKFGXFAVXKIF-UHFFFAOYSA-O.
| Molecular formula | C8H20BF4N |
|---|---|
| Molecular weight | 217.06 g/mol |
| IUPAC name | dibutylazanium tetrafluoroborate |
| InChIKey | CAZKFGXFAVXKIF-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CCCC[NH2+]CCCC |
Computed by PubChem (NCBI)