CAS 790269-39-5 appears in our catalog under these names: Octan-1-aminium tetrafluoroborate, 98%, Poly(9,9-di-n -hexylfluorenyl-2,7-vinylene). Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
Octylazanium tetrafluoroborate (CAS 790269-39-5) is a chemical compound with the molecular formula C8H20BF4N and a molecular weight of 217.06 g/mol. IUPAC name: octylazanium tetrafluoroborate. InChIKey: OFJIUEVKCRHPAA-UHFFFAOYSA-O.
| Molecular formula | C8H20BF4N |
|---|---|
| Molecular weight | 217.06 g/mol |
| IUPAC name | octylazanium tetrafluoroborate |
| InChIKey | OFJIUEVKCRHPAA-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CCCCCCCC[NH3+] |
Computed by PubChem (NCBI)