CAS 121071-71-4 appears in our catalog under these names: Dimethyl 4–aminothiophene–2,3–dicarboxylate hydrochloride, Dimethyl 4-aminothiophene-2,3-dicarboxylate hydrochloride, 97%, Dimethyl 4-aminothiophene-2,3-dicarboxylate hydrochloride, 9, Dimethyl 4-aminothiophene-2,3-dicarboxylate hydrochloride 97%, Dimethyl 4-aminothiophene-2,3-dicarboxylate hydrochloride, 97%, 97%. Offered by: GLPBio, Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
Dimethyl 4-aminothiophene-2,3-dicarboxylate;hydrochloride (CAS 121071-71-4) is a chemical compound with the molecular formula C8H10ClNO4S and a molecular weight of 251.69 g/mol. IUPAC name: dimethyl 4-aminothiophene-2,3-dicarboxylate;hydrochloride. InChIKey: RETIFGMAGNDLAN-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO4S |
|---|---|
| Molecular weight | 251.69 g/mol |
| IUPAC name | dimethyl 4-aminothiophene-2,3-dicarboxylate;hydrochloride |
| InChIKey | RETIFGMAGNDLAN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC=C1N)C(=O)OC.Cl |
Computed by PubChem (NCBI)