Products 1211-40-1
CAS 1211-40-1 appears in our catalog under these names: 4-Amino-4'-nitrobiphenyl, 95%, 4'–Nitro–(1,1'–biphenyl)–4–amine, 4-Amino-4'-nitrobiphenyl, >98.0%(HPLC), 4'-Nitro-[1,1'-biphenyl]-4-amine. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-(4-nitrophenyl)aniline (CAS 1211-40-1) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 4-(4-nitrophenyl)aniline. InChIKey: BOFVBIYTBGDQGY-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 4-(4-nitrophenyl)aniline |
| InChIKey | BOFVBIYTBGDQGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)
Synonyms:
4-Amino-4'-nitrobiphenyl, 4'-Nitro-4-biphenylamine, [1,1'-Biphenyl]-4-amine, 4'-nitro-, 4-Nitro-4'-Aminodiphenyl, Benzenamine, 4-(4-nitrophenyl)-, 4-12-00-03273 (Beilstein Handbook Reference), 4'-Nitro[1,1'-biphenyl]-4-amine, BOFVBIYTBGDQGY-UHFFFAOYSA-N, 4'-Nitro-[1,1'-biphenyl]-4-amine, 4-(4-nitrophenyl)aniline