Products 1211292-75-9
CAS 1211292-75-9 is the registry number for 3-(((4-Fluorophenyl)sulfonyl)methyl)-5-methylisoxazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4-fluorophenyl)sulfonylmethyl]-5-methyl-1,2-oxazole (CAS 1211292-75-9) is a chemical compound with the molecular formula C11H10FNO3S and a molecular weight of 255.27 g/mol. IUPAC name: 3-[(4-fluorophenyl)sulfonylmethyl]-5-methyl-1,2-oxazole. InChIKey: QXBQCYCYNKWTNT-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3S |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)sulfonylmethyl]-5-methyl-1,2-oxazole |
| InChIKey | QXBQCYCYNKWTNT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)CS(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)