Products 675132-23-7
CAS 675132-23-7 is the registry number for 3-[2-(4-Fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione (CAS 675132-23-7) is a chemical compound with the molecular formula C11H10FNO3S and a molecular weight of 255.27 g/mol. IUPAC name: 3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione. InChIKey: UEJDPUMTXLXISG-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3S |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | UEJDPUMTXLXISG-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)CCOC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)