Products 1211333-20-8
CAS 1211333-20-8 appears in our catalog under these names: (18F)AZD4694 Precursor, AZD4694 Precursor, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 10mg, 5mg, 1mg.
Tert-butyl N-[5-[5-(ethoxymethoxy)-1-benzofuran-2-yl]-6-nitro-2-pyridinyl]-N-methylcarbamate (CAS 1211333-20-8) is a chemical compound with the molecular formula C22H25N3O7 and a molecular weight of 443.4 g/mol. IUPAC name: tert-butyl N-[5-[5-(ethoxymethoxy)-1-benzofuran-2-yl]-6-nitro-2-pyridinyl]-N-methylcarbamate. InChIKey: YDLUIXGYKWYMMC-UHFFFAOYSA-N.
| Molecular formula | C22H25N3O7 |
|---|---|
| Molecular weight | 443.4 g/mol |
| IUPAC name | tert-butyl N-[5-[5-(ethoxymethoxy)-1-benzofuran-2-yl]-6-nitro-2-pyridinyl]-N-methylcarbamate |
| InChIKey | YDLUIXGYKWYMMC-UHFFFAOYSA-N |
| SMILES | CCOCOC1=CC2=C(C=C1)OC(=C2)C3=C(N=C(C=C3)N(C)C(=O)OC(C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)