Products 216309-02-3
CAS 216309-02-3 appears in our catalog under these names: AMCA-X, N-succinimidyl ester, AMCA–X， N–succinimidyl ester, AMCA–X SE, AMCA-X N-succinimidyl ester, AMCA-X SE 98+%. Offered by: TRC, GLPBio, Chemat, Ambeed, MedChemExpress. Available pack sizes: 500mg, 10mg, 1mg, 100mg, 5mg, 25mg, 1 mg.
(2,5-dioxopyrrolidin-1-yl) 6-[[2-(7-amino-4-methyl-2-oxochromen-3-yl)acetyl]amino]hexanoate (CAS 216309-02-3) is a chemical compound with the molecular formula C22H25N3O7 and a molecular weight of 443.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 6-[[2-(7-amino-4-methyl-2-oxochromen-3-yl)acetyl]amino]hexanoate. InChIKey: QYSJBOMZRLAPJR-UHFFFAOYSA-N.
| Molecular formula | C22H25N3O7 |
|---|---|
| Molecular weight | 443.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 6-[[2-(7-amino-4-methyl-2-oxochromen-3-yl)acetyl]amino]hexanoate |
| InChIKey | QYSJBOMZRLAPJR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)N)CC(=O)NCCCCCC(=O)ON3C(=O)CCC3=O |
Computed by PubChem (NCBI)