Products 1211499-08-9

CAS 1211499-08-9 is the registry number for Ethyl 2-(methylamino)-1,3-thiazole-4-carboxylate hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(methylamino)-1,3-thiazole-4-carboxylate;hydrobromide (CAS 1211499-08-9) is a chemical compound with the molecular formula C7H11BrN2O2S and a molecular weight of 267.15 g/mol. IUPAC name: ethyl 2-(methylamino)-1,3-thiazole-4-carboxylate;hydrobromide. InChIKey: OGAFIRKGSSJVQA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11BrN2O2S
Molecular weight267.15 g/mol
IUPAC nameethyl 2-(methylamino)-1,3-thiazole-4-carboxylate;hydrobromide
InChIKeyOGAFIRKGSSJVQA-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)NC.Br

Computed by PubChem (NCBI)