CAS 1698909-07-7 appears in our catalog under these names: Ethyl 2-amino-5-methylthiazole-4-carboxylate hydrobromide, 95%, Ethyl 2-amino-5-methylthiazole-4-carboxylate hydrobromide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
Ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate;hydrobromide (CAS 1698909-07-7) is a chemical compound with the molecular formula C7H11BrN2O2S and a molecular weight of 267.15 g/mol. IUPAC name: ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate;hydrobromide. InChIKey: TVFMXBVAGQYXQC-UHFFFAOYSA-N.
| Molecular formula | C7H11BrN2O2S |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate;hydrobromide |
| InChIKey | TVFMXBVAGQYXQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=N1)N)C.Br |
Computed by PubChem (NCBI)