CAS 1211510-85-8 appears in our catalog under these names: 2-(Chloromethyl)-4-(2-chlorophenyl)-1,3-thiazole, 95%, 2-(Chloromethyl)-4-(2-chlorophenyl)-1,3-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(chloromethyl)-4-(2-chlorophenyl)-1,3-thiazole (CAS 1211510-85-8) is a chemical compound with the molecular formula C10H7Cl2NS and a molecular weight of 244.14 g/mol. IUPAC name: 2-(chloromethyl)-4-(2-chlorophenyl)-1,3-thiazole. InChIKey: KSABEYVZHUZPFK-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NS |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 2-(chloromethyl)-4-(2-chlorophenyl)-1,3-thiazole |
| InChIKey | KSABEYVZHUZPFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC(=N2)CCl)Cl |
Computed by PubChem (NCBI)