Products 1342394-08-4
CAS 1342394-08-4 is the registry number for 2-(Chloromethyl)-4-(3-chlorophenyl)thiazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(chloromethyl)-4-(3-chlorophenyl)-1,3-thiazole (CAS 1342394-08-4) is a chemical compound with the molecular formula C10H7Cl2NS and a molecular weight of 244.14 g/mol. IUPAC name: 2-(chloromethyl)-4-(3-chlorophenyl)-1,3-thiazole. InChIKey: DXWOJURLWQMDQV-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NS |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 2-(chloromethyl)-4-(3-chlorophenyl)-1,3-thiazole |
| InChIKey | DXWOJURLWQMDQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CSC(=N2)CCl |
Computed by PubChem (NCBI)