Products 1211537-27-7
CAS 1211537-27-7 appears in our catalog under these names: 6-Cyano-2-(trifluoromethyl)nicotinic acid, 95%, 6-Cyano-2-(trifluoromethyl)nicotinic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-cyano-2-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1211537-27-7) is a chemical compound with the molecular formula C8H3F3N2O2 and a molecular weight of 216.12 g/mol. IUPAC name: 6-cyano-2-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: MFALOKVJQIUJKP-UHFFFAOYSA-N.
| Molecular formula | C8H3F3N2O2 |
|---|---|
| Molecular weight | 216.12 g/mol |
| IUPAC name | 6-cyano-2-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | MFALOKVJQIUJKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1C#N)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)