Products 1379375-69-5
CAS 1379375-69-5 is the registry number for 4-Cyano-6-(trifluoromethyl)picolinic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-cyano-6-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1379375-69-5) is a chemical compound with the molecular formula C8H3F3N2O2 and a molecular weight of 216.12 g/mol. IUPAC name: 4-cyano-6-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: IXMXTNUUHMVIBK-UHFFFAOYSA-N.
| Molecular formula | C8H3F3N2O2 |
|---|---|
| Molecular weight | 216.12 g/mol |
| IUPAC name | 4-cyano-6-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | IXMXTNUUHMVIBK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)O)C(F)(F)F)C#N |
Computed by PubChem (NCBI)