CAS 1211538-92-9 is the registry number for tert-Butyl 4-(5-bromopyrimidin-2-yl)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g.
Tert-butyl 4-(5-bromopyrimidin-2-yl)piperidine-1-carboxylate (CAS 1211538-92-9) is a chemical compound with the molecular formula C14H20BrN3O2 and a molecular weight of 342.23 g/mol. IUPAC name: tert-butyl 4-(5-bromopyrimidin-2-yl)piperidine-1-carboxylate. InChIKey: UIDYGYFDXWZJPC-UHFFFAOYSA-N.
| Molecular formula | C14H20BrN3O2 |
|---|---|
| Molecular weight | 342.23 g/mol |
| IUPAC name | tert-butyl 4-(5-bromopyrimidin-2-yl)piperidine-1-carboxylate |
| InChIKey | UIDYGYFDXWZJPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)