Products 1211585-89-5
CAS 1211585-89-5 is the registry number for 5-Bromo-2-(piperidin-4-yl)-4-(trifluoromethyl)thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-piperidin-4-yl-4-(trifluoromethyl)-1,3-thiazole (CAS 1211585-89-5) is a chemical compound with the molecular formula C9H10BrF3N2S and a molecular weight of 315.16 g/mol. IUPAC name: 5-bromo-2-piperidin-4-yl-4-(trifluoromethyl)-1,3-thiazole. InChIKey: OLMNPZJRMLHHBS-UHFFFAOYSA-N.
| Molecular formula | C9H10BrF3N2S |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | 5-bromo-2-piperidin-4-yl-4-(trifluoromethyl)-1,3-thiazole |
| InChIKey | OLMNPZJRMLHHBS-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=NC(=C(S2)Br)C(F)(F)F |
Computed by PubChem (NCBI)