CAS 938156-44-6 is the registry number for (([4-(Trifluoromethyl)phenyl]methyl)sulfanyl)methanimidamide hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 200mg.
[4-(trifluoromethyl)phenyl]methyl carbamimidothioate;hydrobromide (CAS 938156-44-6) is a chemical compound with the molecular formula C9H10BrF3N2S and a molecular weight of 315.16 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl]methyl carbamimidothioate;hydrobromide. InChIKey: DQUSQKCHQOOEIJ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrF3N2S |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl]methyl carbamimidothioate;hydrobromide |
| InChIKey | DQUSQKCHQOOEIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC(=N)N)C(F)(F)F.Br |
Computed by PubChem (NCBI)