CAS 1211588-58-7 appears in our catalog under these names: 3-Bromo-5-chloro-1,6-naphthyridine, 95%, 3-Bromo-5-chloro-1,6-naphthyridine, 3-Bromo-5-chloro-1,6-naphthyridine, 97%, 3-Bromo-5-chloro-1,6-naphthyridine, 97%, 97%. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g.
3-bromo-5-chloro-1,6-naphthyridine (CAS 1211588-58-7) is a chemical compound with the molecular formula C8H4BrClN2 and a molecular weight of 243.49 g/mol. IUPAC name: 3-bromo-5-chloro-1,6-naphthyridine. InChIKey: JVIVRUOCTAGPAE-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2 |
|---|---|
| Molecular weight | 243.49 g/mol |
| IUPAC name | 3-bromo-5-chloro-1,6-naphthyridine |
| InChIKey | JVIVRUOCTAGPAE-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1N=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)