CAS 1011291-78-3 appears in our catalog under these names: 7-Bromo-1-chlorophthalazine, 95%, 7–Bromo–1–chlorophthalazine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 50mg.
7-bromo-1-chlorophthalazine (CAS 1011291-78-3) is a chemical compound with the molecular formula C8H4BrClN2 and a molecular weight of 243.49 g/mol. IUPAC name: 7-bromo-1-chlorophthalazine. InChIKey: RPTPXZOSFDMHMI-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2 |
|---|---|
| Molecular weight | 243.49 g/mol |
| IUPAC name | 7-bromo-1-chlorophthalazine |
| InChIKey | RPTPXZOSFDMHMI-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=NC(=C2C=C1Br)Cl |
Computed by PubChem (NCBI)