CAS 909649-12-3 appears in our catalog under these names: 8-Bromo-5-chloro-1,6-naphthyridine, 95%, 8-Bromo-5-chloro-1,6-naphthyridine, 97%, 8-bromo-5-chloro-1,6-naphthyridine, 1,6-Naphthyridine, 8-bromo-5-chloro-, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg, 100mg, 250mg, 500mg.
8-bromo-5-chloro-1,6-naphthyridine (CAS 909649-12-3) is a chemical compound with the molecular formula C8H4BrClN2 and a molecular weight of 243.49 g/mol. IUPAC name: 8-bromo-5-chloro-1,6-naphthyridine. InChIKey: LAJYLYMBZVFAEY-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2 |
|---|---|
| Molecular weight | 243.49 g/mol |
| IUPAC name | 8-bromo-5-chloro-1,6-naphthyridine |
| InChIKey | LAJYLYMBZVFAEY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2Cl)Br)N=C1 |
Computed by PubChem (NCBI)