CAS 1211594-38-5 is the registry number for 5–(Trifluoromethyl)–2,3–dihydrospiro–(indene–1,2'–pyrrolidine). Offered by: GLPBio. Available pack sizes: 1g, 250mg.
6-(trifluoromethyl)spiro[1,2-dihydroindene-3,2'-pyrrolidine] (CAS 1211594-38-5) is a chemical compound with the molecular formula C13H14F3N and a molecular weight of 241.25 g/mol. IUPAC name: 6-(trifluoromethyl)spiro[1,2-dihydroindene-3,2'-pyrrolidine]. InChIKey: JHRCMLWHFCYKJY-UHFFFAOYSA-N.
| Molecular formula | C13H14F3N |
|---|---|
| Molecular weight | 241.25 g/mol |
| IUPAC name | 6-(trifluoromethyl)spiro[1,2-dihydroindene-3,2'-pyrrolidine] |
| InChIKey | JHRCMLWHFCYKJY-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC3=C2C=CC(=C3)C(F)(F)F)NC1 |
Computed by PubChem (NCBI)