CAS 2580253-68-3 is the registry number for 1-(4-(Trifluoromethyl)phenyl)-2-azaspiro(3.3)heptane, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.3]heptane (CAS 2580253-68-3) is a chemical compound with the molecular formula C13H14F3N and a molecular weight of 241.25 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.3]heptane. InChIKey: DSPCCVMBEYYQJP-UHFFFAOYSA-N.
| Molecular formula | C13H14F3N |
|---|---|
| Molecular weight | 241.25 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.3]heptane |
| InChIKey | DSPCCVMBEYYQJP-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CNC2C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)