CAS 1212021-54-9 appears in our catalog under these names: 3,5-Dicyanophenylboronic Acid, (3,5-Dicyanophenyl)boronic acid 98%, (3,5-DICYANOPHENYL)BORONIC ACID, 98%, 98%, (3,5-Dicyanophenyl)boronic acid, 98%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(3,5-dicyanophenyl)boronic acid (CAS 1212021-54-9) is a chemical compound with the molecular formula C8H5BN2O2 and a molecular weight of 171.95 g/mol. IUPAC name: (3,5-dicyanophenyl)boronic acid. InChIKey: XNHAOCLTPNZEFX-UHFFFAOYSA-N.
| Molecular formula | C8H5BN2O2 |
|---|---|
| Molecular weight | 171.95 g/mol |
| IUPAC name | (3,5-dicyanophenyl)boronic acid |
| InChIKey | XNHAOCLTPNZEFX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C#N)C#N)(O)O |
Computed by PubChem (NCBI)