CAS 232275-35-3 appears in our catalog under these names: (2,6-Dicyanophenyl)boronic acid, 98% ,, 98% ,, (2,6-Dicyanophenyl)boronic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2,6-dicyanophenyl)boronic acid (CAS 232275-35-3) is a chemical compound with the molecular formula C8H5BN2O2 and a molecular weight of 171.95 g/mol. IUPAC name: (2,6-dicyanophenyl)boronic acid. InChIKey: PDDYOFMHLZZSQJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BN2O2 |
|---|---|
| Molecular weight | 171.95 g/mol |
| IUPAC name | (2,6-dicyanophenyl)boronic acid |
| InChIKey | PDDYOFMHLZZSQJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1C#N)C#N)(O)O |
Computed by PubChem (NCBI)