CAS 1212105-25-3 appears in our catalog under these names: (1R,5S)-rel-3-Azabicyclo[3.1.0]hexane-6-carboxylic acid hydrochloride, 95%, rel-(1R,5S,6r)-3-Azabicyclo(3.1.0)hexane-6-carboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 10g.
(1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid;hydrochloride (CAS 1212105-25-3) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid;hydrochloride. InChIKey: KDPCJMUQSXUTHG-FLGDEJNQSA-N.
| Molecular formula | C6H10ClNO2 |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid;hydrochloride |
| InChIKey | KDPCJMUQSXUTHG-FLGDEJNQSA-N |
| SMILES | C1[C@@H]2[C@@H](C2C(=O)O)CN1.Cl |
Computed by PubChem (NCBI)