Products 332064-87-6

CAS 332064-87-6 appears in our catalog under these names: (R)-3-Amino-5-hexynoic acid hydrochloride, 95%, (R)-3-Aminohex-5-ynoic acid hydrochloride, 95%, 95%, (R)-3-Aminohex-5-ynoic acid hydrochloride, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(3R)-3-aminohex-5-ynoic acid;hydrochloride (CAS 332064-87-6) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (3R)-3-aminohex-5-ynoic acid;hydrochloride. InChIKey: FVKOZZHCHSRKJA-NUBCRITNSA-N.

Identity
Molecular formulaC6H10ClNO2
Molecular weight163.60 g/mol
IUPAC name(3R)-3-aminohex-5-ynoic acid;hydrochloride
InChIKeyFVKOZZHCHSRKJA-NUBCRITNSA-N
SMILESC#CC[C@H](CC(=O)O)N.Cl

Computed by PubChem (NCBI)