CAS 1212132-12-1 is the registry number for Rel-(1S,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2R,3S,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid;hydrochloride (CAS 1212132-12-1) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: (1S,2R,3S,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid;hydrochloride. InChIKey: GVGHCTZKPYWADE-MBWJBUSCSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | (1S,2R,3S,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid;hydrochloride |
| InChIKey | GVGHCTZKPYWADE-MBWJBUSCSA-N |
| SMILES | C1C[C@@H]2C[C@H]1[C@H]([C@H]2N)C(=O)O.Cl |
Computed by PubChem (NCBI)