Products 1212145-57-7
CAS 1212145-57-7 appears in our catalog under these names: 5-Phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid, 95%, 5-Phenylbicyclo(2.2.1)heptane-2,3-dicarboxylic acid, 97%, 5-Phenylbicyclo[2.2.1]Heptane-2,3-dicarboxylic acid, 96%, 96%, 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid (CAS 1212145-57-7) is a chemical compound with the molecular formula C15H16O4 and a molecular weight of 260.28 g/mol. IUPAC name: 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid. InChIKey: FVOPGJHWZNSVSQ-UHFFFAOYSA-N.
| Molecular formula | C15H16O4 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| InChIKey | FVOPGJHWZNSVSQ-UHFFFAOYSA-N |
| SMILES | C1C2CC(C1C(C2C(=O)O)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)