CAS 314742-02-4 is the registry number for 3,4-Dimethyl-7-(1-methyl-2-oxopropoxy)-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3,4-dimethyl-7-(3-oxobutan-2-yloxy)chromen-2-one (CAS 314742-02-4) is a chemical compound with the molecular formula C15H16O4 and a molecular weight of 260.28 g/mol. IUPAC name: 3,4-dimethyl-7-(3-oxobutan-2-yloxy)chromen-2-one. InChIKey: DZNZFKVXGBBLCI-UHFFFAOYSA-N.
| Molecular formula | C15H16O4 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | 3,4-dimethyl-7-(3-oxobutan-2-yloxy)chromen-2-one |
| InChIKey | DZNZFKVXGBBLCI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)OC(C)C(=O)C)C |
Computed by PubChem (NCBI)