CAS 1212147-76-6 appears in our catalog under these names: Meso-(1r,5s,6r)-6-(fluoromethyl)-3-azabicyclo[3.1.0]hexane hydrochloride, 95%, exo-6-(Fluoromethyl)-3-azabicyclo(3.1.0)hexane hydrochloride, 97%, 6-(Fluoromethyl)-3-azabicyclo(3.1.0)hexane hydrochloride, endo, exo-6-(Fluoromethyl)-3-azabicyclo[3.1.0]hexane hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg, 100mg, 500mg.
(1S,5R)-6-(fluoromethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 1212147-76-6) is a chemical compound with the molecular formula C6H11ClFN and a molecular weight of 151.61 g/mol. IUPAC name: (1S,5R)-6-(fluoromethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: FPDSLCOFKNCANY-DKECMWHCSA-N.
| Molecular formula | C6H11ClFN |
|---|---|
| Molecular weight | 151.61 g/mol |
| IUPAC name | (1S,5R)-6-(fluoromethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | FPDSLCOFKNCANY-DKECMWHCSA-N |
| SMILES | C1[C@@H]2[C@@H](C2CF)CN1.Cl |
Computed by PubChem (NCBI)