Products 2206606-63-3
CAS 2206606-63-3 appears in our catalog under these names: exo-5-fluoro-2-azabicyclo[2.2.1]heptane hydrochloride, 95%, exo-5-fluoro-2-azabicyclo[2.2.1]heptane hydrochloride, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
(1R,4R,5S)-5-fluoro-2-azabicyclo[2.2.1]heptane;hydrochloride (CAS 2206606-63-3) is a chemical compound with the molecular formula C6H11ClFN and a molecular weight of 151.61 g/mol. IUPAC name: (1R,4R,5S)-5-fluoro-2-azabicyclo[2.2.1]heptane;hydrochloride. InChIKey: SNXRMQLHOJPLRM-JMWSHJPJSA-N.
| Molecular formula | C6H11ClFN |
|---|---|
| Molecular weight | 151.61 g/mol |
| IUPAC name | (1R,4R,5S)-5-fluoro-2-azabicyclo[2.2.1]heptane;hydrochloride |
| InChIKey | SNXRMQLHOJPLRM-JMWSHJPJSA-N |
| SMILES | C1[C@@H]2C[C@@H]([C@H]1CN2)F.Cl |
Computed by PubChem (NCBI)