CAS 1212253-95-6 is the registry number for Cis-2-hydroxymethyl-1-methyl-1-cyclohexylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
[(1R,2S)-2-amino-2-methylcyclohexyl]methanol;hydrochloride (CAS 1212253-95-6) is a chemical compound with the molecular formula C8H18ClNO and a molecular weight of 179.69 g/mol. IUPAC name: [(1R,2S)-2-amino-2-methylcyclohexyl]methanol;hydrochloride. InChIKey: PYACCMCUCGVBDM-WSZWBAFRSA-N.
| Molecular formula | C8H18ClNO |
|---|---|
| Molecular weight | 179.69 g/mol |
| IUPAC name | [(1R,2S)-2-amino-2-methylcyclohexyl]methanol;hydrochloride |
| InChIKey | PYACCMCUCGVBDM-WSZWBAFRSA-N |
| SMILES | C[C@@]1(CCCC[C@H]1CO)N.Cl |
Computed by PubChem (NCBI)