Products 2089310-95-0
CAS 2089310-95-0 appears in our catalog under these names: Cis-3-(dimethylamino)cyclohexanol hydrochloride, 95%, cis-3-(Dimethylamino)cyclohexanol hydrochloride 97%, cis-3-(Dimethylamino)cyclohexanol hydrochloride, 97%, 97%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg.
Cis-(1S,3R)-3-(dimethylamino)cyclohexan-1-ol;hydrochloride (CAS 2089310-95-0) is a chemical compound with the molecular formula C8H18ClNO and a molecular weight of 179.69 g/mol. IUPAC name: cis-(1S,3R)-3-(dimethylamino)cyclohexan-1-ol;hydrochloride. InChIKey: MBQMFGCEHCJMHL-WLYNEOFISA-N.
| Molecular formula | C8H18ClNO |
|---|---|
| Molecular weight | 179.69 g/mol |
| IUPAC name | cis-(1S,3R)-3-(dimethylamino)cyclohexan-1-ol;hydrochloride |
| InChIKey | MBQMFGCEHCJMHL-WLYNEOFISA-N |
| SMILES | CN(C)[C@@H]1CCC[C@@H](C1)O.Cl |
Computed by PubChem (NCBI)