CAS 1212269-83-4 is the registry number for Cis-5-methyl-2,3,3a,4,7,7a-hexahydro-1h-isoindole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3aR,7aS)-5-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindole (CAS 1212269-83-4) is a chemical compound with the molecular formula C9H15N and a molecular weight of 137.22 g/mol. IUPAC name: (3aR,7aS)-5-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindole. InChIKey: OVBKKDSRBCCWSP-BDAKNGLRSA-N.
| Molecular formula | C9H15N |
|---|---|
| Molecular weight | 137.22 g/mol |
| IUPAC name | (3aR,7aS)-5-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindole |
| InChIKey | OVBKKDSRBCCWSP-BDAKNGLRSA-N |
| SMILES | CC1=CC[C@@H]2CNC[C@@H]2C1 |
Computed by PubChem (NCBI)