Products 1932378-44-3
CAS 1932378-44-3 is the registry number for Rac-(2r,6r)-2-allyl-6-methyl-1,2,3,6-tetrahydropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
(2R,6R)-6-methyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine (CAS 1932378-44-3) is a chemical compound with the molecular formula C9H15N and a molecular weight of 137.22 g/mol. IUPAC name: (2R,6R)-6-methyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine. InChIKey: PSNCFOFVFFJWLI-RKDXNWHRSA-N.
| Molecular formula | C9H15N |
|---|---|
| Molecular weight | 137.22 g/mol |
| IUPAC name | (2R,6R)-6-methyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine |
| InChIKey | PSNCFOFVFFJWLI-RKDXNWHRSA-N |
| SMILES | C[C@@H]1C=CC[C@H](N1)CC=C |
Computed by PubChem (NCBI)