Products 1212276-33-9
CAS 1212276-33-9 appears in our catalog under these names: Ezetimibe Impurity 53, Ezetimibe Impurity 87. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(4S)-3-(2,2-dimethylpropanoyl)-4-phenyl-1,3-oxazolidin-2-one (CAS 1212276-33-9) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: (4S)-3-(2,2-dimethylpropanoyl)-4-phenyl-1,3-oxazolidin-2-one. InChIKey: RCYGSFKQQKHMBE-LLVKDONJSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | (4S)-3-(2,2-dimethylpropanoyl)-4-phenyl-1,3-oxazolidin-2-one |
| InChIKey | RCYGSFKQQKHMBE-LLVKDONJSA-N |
| SMILES | CC(C)(C)C(=O)N1[C@H](COC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
(S)-4-phenyl-3-pivaloyloxazolidin-2-one